C15H19FN4O — CID 139439416
4-[(1Z,4E)-6-(dimethylamino)-3-ethyl-2-fluorohexa-1,4-dienoxy]pyrimidine-2-carbonitrile (PubChem CID 139439416) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-[(1Z,4E)-6-(dimethylamino)-3-ethyl-2-fluorohexa-1,4-dienoxy]pyrimidine-2-carbonitrile.
| Compound Name | 4-[(1Z,4E)-6-(dimethylamino)-3-ethyl-2-fluorohexa-1,4-dienoxy]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 139439416 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-[(1Z,4E)-6-(dimethylamino)-3-ethyl-2-fluorohexa-1,4-dienoxy]pyrimidine-2-carbonitrile |
| SMILES | CCC(/C=C/CN(C)C)/C(F)=C/Oc1ccnc(C#N)n1 |
| InChI | InChI=1S/C15H19FN4O/c1-4-12(6-5-9-20(2)3)13(16)11-21-15-7-8-18-14(10-17)19-15/h5-8,11-12H,4,9H2,1-3H3/b6-5+,13-11- |
| InChIKey | BAXDYCBLLPEGOH-YMDBXOBFSA-N |
| XLogP | 2.68 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|