C20H26FN5 — CID 139439550
(2Z,4Z)-1-[3-(6-amino-1,2-dihydropyrazin-3-yl)-6-cyclobutyl-2-fluorophenyl]hexa-2,4-diene-2,5-diamine (PubChem CID 139439550) has the molecular formula C20H26FN5 and a molecular weight of 355.46 g/mol. Its IUPAC name is (2Z,4Z)-1-[3-(6-amino-1,2-dihydropyrazin-3-yl)-6-cyclobutyl-2-fluorophenyl]hexa-2,4-diene-2,5-diamine.
| Compound Name | (2Z,4Z)-1-[3-(6-amino-1,2-dihydropyrazin-3-yl)-6-cyclobutyl-2-fluorophenyl]hexa-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 139439550 |
| Molecular Formula | C20H26FN5 |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | (2Z,4Z)-1-[3-(6-amino-1,2-dihydropyrazin-3-yl)-6-cyclobutyl-2-fluorophenyl]hexa-2,4-diene-2,5-diamine |
| SMILES | C/C(N)=C/C=C(\N)Cc1c(C2CCC2)ccc(C2=NC=C(N)NC2)c1F |
| InChI | InChI=1S/C20H26FN5/c1-12(22)5-6-14(23)9-17-15(13-3-2-4-13)7-8-16(20(17)21)18-10-26-19(24)11-25-18/h5-8,11,13,26H,2-4,9-10,22-24H2,1H3/b12-5-,14-6- |
| InChIKey | VOYACZHRHKPKFH-ZVKDIXJXSA-N |
| XLogP | 2.49 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|