C17H31N — CID 139439590
(Z,4S)-N,4,11-trimethyl-7-methylidenetridec-5-en-1-imine (PubChem CID 139439590) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (Z,4S)-N,4,11-trimethyl-7-methylidenetridec-5-en-1-imine.
| Compound Name | (Z,4S)-N,4,11-trimethyl-7-methylidenetridec-5-en-1-imine |
|---|---|
| PubChem CID | 139439590 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (Z,4S)-N,4,11-trimethyl-7-methylidenetridec-5-en-1-imine |
| SMILES | C=C(/C=C\[C@@H](C)CC/C=N/C)CCCC(C)CC |
| InChI | InChI=1S/C17H31N/c1-6-15(2)9-7-10-16(3)12-13-17(4)11-8-14-18-5/h12-15,17H,3,6-11H2,1-2,4-5H3/b13-12-,18-14+/t15?,17-/m0/s1 |
| InChIKey | ROYFLXYGZWSQPG-ZMPOPWDGSA-N |
| XLogP | 5.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|