C18H33FN2 — CID 139439665
(Z)-N'-ethyl-2-[(3Z)-3-fluoro-8-methylundeca-1,3-dien-4-yl]-N-methylprop-1-ene-1,3-diamine (PubChem CID 139439665) has the molecular formula C18H33FN2 and a molecular weight of 296.47 g/mol. Its IUPAC name is (Z)-N'-ethyl-2-[(3Z)-3-fluoro-8-methylundeca-1,3-dien-4-yl]-N-methylprop-1-ene-1,3-diamine.
| Compound Name | (Z)-N'-ethyl-2-[(3Z)-3-fluoro-8-methylundeca-1,3-dien-4-yl]-N-methylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 139439665 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | (Z)-N'-ethyl-2-[(3Z)-3-fluoro-8-methylundeca-1,3-dien-4-yl]-N-methylprop-1-ene-1,3-diamine |
| SMILES | C=C/C(F)=C(CCCC(C)CCC)/C(=C/NC)CNCC |
| InChI | InChI=1S/C18H33FN2/c1-6-10-15(4)11-9-12-17(18(19)7-2)16(13-20-5)14-21-8-3/h7,13,15,20-21H,2,6,8-12,14H2,1,3-5H3/b16-13+,18-17- |
| InChIKey | GPIHXGIJZMSXCA-XJQDBPQSSA-N |
| XLogP | 4.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|