C27H25F2N5O3S — CID 139440031
2-[6-[(1R,8S)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.3.2.02,7]trideca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-(2-methylsulfonylethyl)-1,3-oxazole (PubChem CID 139440031) has the molecular formula C27H25F2N5O3S and a molecular weight of 537.59 g/mol. Its IUPAC name is 2-[6-[(1R,8S)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.3.2.02,7]trideca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-(2-methylsulfonylethyl)-1,3-oxazole.
| Compound Name | 2-[6-[(1R,8S)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.3.2.02,7]trideca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-(2-methylsulfonylethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 139440031 |
| Molecular Formula | C27H25F2N5O3S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2-[6-[(1R,8S)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.3.2.02,7]trideca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-(2-methylsulfonylethyl)-1,3-oxazole |
| SMILES | CS(=O)(=O)CCc1coc(-c2cncc([C@@]34CCC[C@@H](CC3)c3cc(-c5c(F)cccc5F)nnc34)n2)n1 |
| InChI | InChI=1S/C27H25F2N5O3S/c1-38(35,36)11-8-17-15-37-26(31-17)22-13-30-14-23(32-22)27-9-3-4-16(7-10-27)18-12-21(33-34-25(18)27)24-19(28)5-2-6-20(24)29/h2,5-6,12-16H,3-4,7-11H2,1H3/t16-,27+/m0/s1 |
| InChIKey | DDMVCRLPFRPDQB-RKOGDMNLSA-N |
| XLogP | 4.80 |
| TPSA | 111.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |