C27H16ClN3S — CID 139440424
2-(6-chlorodibenzothiophen-2-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 139440424) has the molecular formula C27H16ClN3S and a molecular weight of 449.97 g/mol. Its IUPAC name is 2-(6-chlorodibenzothiophen-2-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(6-chlorodibenzothiophen-2-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139440424 |
| Molecular Formula | C27H16ClN3S |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-(6-chlorodibenzothiophen-2-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1cccc2c1sc1ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc12 |
| InChI | InChI=1S/C27H16ClN3S/c28-22-13-7-12-20-21-16-19(14-15-23(21)32-24(20)22)27-30-25(17-8-3-1-4-9-17)29-26(31-27)18-10-5-2-6-11-18/h1-16H |
| InChIKey | JGNIPEMQNKEMDO-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |