C20H26N2O2S — CID 139441105
9-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide (PubChem CID 139441105) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 9-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide.
| Compound Name | 9-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
|---|---|
| PubChem CID | 139441105 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 9-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
| SMILES | C=C/C=C\C=C(/C)C1CCC(C2=CC=CN3CCS(=O)(=O)N=C23)CC1 |
| InChI | InChI=1S/C20H26N2O2S/c1-3-4-5-7-16(2)17-9-11-18(12-10-17)19-8-6-13-22-14-15-25(23,24)21-20(19)22/h3-8,13,17-18H,1,9-12,14-15H2,2H3/b5-4-,16-7+ |
| InChIKey | DAZZGHVVDWBMNO-NXJGATQJSA-N |
| XLogP | 3.98 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|