About [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol
[2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol (PubChem CID 139441367) has the molecular formula C17H14F2N2O3
and a molecular weight of 332.31 g/mol. Its IUPAC name is [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol.
Molecular Properties
| Compound Name | [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol |
| PubChem CID | 139441367 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol |
| SMILES | COC(O)c1ccccc1-c1cnc(Nc2cc(F)ccc2F)o1 |
| InChI | InChI=1S/C17H14F2N2O3/c1-23-16(22)12-5-3-2-4-11(12)15-9-20-17(24-15)21-14-8-10(18)6-7-13(14)19/h2-9,16,22H,1H3,(H,20,21) |
| InChIKey | VZSPECCWIAUQTM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol?
The IUPAC name of [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol (CID 139441367) is [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol.
What is the SMILES notation for [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol?
The canonical SMILES for [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol is COC(O)c1ccccc1-c1cnc(Nc2cc(F)ccc2F)o1.
What is the InChIKey of [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol?
The InChIKey is VZSPECCWIAUQTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N2O3/c1-23-16(22)12-5-3-2-4-11(12)15-9-20-17(24-15)21-14-8-10(18)6-7-13(14)19/h2-9,16,22H,1H3,(H,20,21).
What are the key properties of [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol?
[2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol has a molecular weight of 332.31 g/mol, XLogP of 4.00, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,5-difluoroanilino)-1,3-oxazol-5-yl]phenyl]-methoxymethanol is sourced from PubChem (CID 139441367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).