C23H29NO6 — CID 139442001
[(7aR,12bS)-4a-acetyloxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 139442001) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is [(7aR,12bS)-4a-acetyloxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [(7aR,12bS)-4a-acetyloxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 139442001 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [(7aR,12bS)-4a-acetyloxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | COc1ccc(C)c2c1O[C@H]1C(OC(C)=O)=CCC3(OC(C)=O)C(C)N(C)CC[C@]213 |
| InChI | InChI=1S/C23H29NO6/c1-13-7-8-17(27-6)20-19(13)22-11-12-24(5)14(2)23(22,30-16(4)26)10-9-18(21(22)29-20)28-15(3)25/h7-9,14,21H,10-12H2,1-6H3/t14?,21-,22-,23?/m0/s1 |
| InChIKey | QOOPCEAVALDZHJ-CVRONBDISA-N |
| XLogP | 2.88 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |