About 6,6-dimethyl-1,4-diazocane
6,6-dimethyl-1,4-diazocane (PubChem CID 139442519) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 6,6-dimethyl-1,4-diazocane.
Molecular Properties
| Compound Name | 6,6-dimethyl-1,4-diazocane |
| PubChem CID | 139442519 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 6,6-dimethyl-1,4-diazocane |
| SMILES | CC1(C)CCNCCNC1 |
| InChI | InChI=1S/C8H18N2/c1-8(2)3-4-9-5-6-10-7-8/h9-10H,3-7H2,1-2H3 |
| InChIKey | MIKWYYDCBPEPCX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethyl-1,4-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1,4-diazocane?
The IUPAC name of 6,6-dimethyl-1,4-diazocane (CID 139442519) is 6,6-dimethyl-1,4-diazocane.
What is the SMILES notation for 6,6-dimethyl-1,4-diazocane?
The canonical SMILES for 6,6-dimethyl-1,4-diazocane is CC1(C)CCNCCNC1.
What is the InChIKey of 6,6-dimethyl-1,4-diazocane?
The InChIKey is MIKWYYDCBPEPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-8(2)3-4-9-5-6-10-7-8/h9-10H,3-7H2,1-2H3.
What are the key properties of 6,6-dimethyl-1,4-diazocane?
6,6-dimethyl-1,4-diazocane has a molecular weight of 142.25 g/mol, XLogP of 0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1,4-diazocane is sourced from PubChem (CID 139442519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).