About [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine
[4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine (PubChem CID 139442597) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine.
Molecular Properties
| Compound Name | [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine |
| PubChem CID | 139442597 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine |
| SMILES | CCC(C1C=C(C(C)(C)C)C=CC1NN)C(C)(C)C |
| InChI | InChI=1S/C17H32N2/c1-8-14(17(5,6)7)13-11-12(16(2,3)4)9-10-15(13)19-18/h9-11,13-15,19H,8,18H2,1-7H3 |
| InChIKey | BSGLUSHKNJKWRV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine?
The IUPAC name of [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine (CID 139442597) is [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine.
What is the SMILES notation for [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine?
The canonical SMILES for [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine is CCC(C1C=C(C(C)(C)C)C=CC1NN)C(C)(C)C.
What is the InChIKey of [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine?
The InChIKey is BSGLUSHKNJKWRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2/c1-8-14(17(5,6)7)13-11-12(16(2,3)4)9-10-15(13)19-18/h9-11,13-15,19H,8,18H2,1-7H3.
What are the key properties of [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine?
[4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine has a molecular weight of 264.46 g/mol, XLogP of 4.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tert-butyl-6-(2,2-dimethylpentan-3-yl)cyclohexa-2,4-dien-1-yl]hydrazine is sourced from PubChem (CID 139442597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).