About methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate
methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate (PubChem CID 139442666) has the molecular formula C20H29N5O2
and a molecular weight of 371.49 g/mol. Its IUPAC name is methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate |
| PubChem CID | 139442666 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate |
| SMILES | CNc1[nH]c2cc(C(=O)OC)ccc2c1/C(N)=N/CCCN1CCCCC1 |
| InChI | InChI=1S/C20H29N5O2/c1-22-19-17(15-8-7-14(20(26)27-2)13-16(15)24-19)18(21)23-9-6-12-25-10-4-3-5-11-25/h7-8,13,22,24H,3-6,9-12H2,1-2H3,(H2,21,23) |
| InChIKey | XBFMVSHFUKVWHF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate?
The IUPAC name of methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate (CID 139442666) is methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate.
What is the SMILES notation for methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate?
The canonical SMILES for methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate is CNc1[nH]c2cc(C(=O)OC)ccc2c1/C(N)=N/CCCN1CCCCC1.
What is the InChIKey of methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate?
The InChIKey is XBFMVSHFUKVWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N5O2/c1-22-19-17(15-8-7-14(20(26)27-2)13-16(15)24-19)18(21)23-9-6-12-25-10-4-3-5-11-25/h7-8,13,22,24H,3-6,9-12H2,1-2H3,(H2,21,23).
What are the key properties of methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate?
methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate has a molecular weight of 371.49 g/mol, XLogP of 2.58, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(methylamino)-3-[N'-(3-piperidin-1-ylpropyl)carbamimidoyl]-1H-indole-6-carboxylate is sourced from PubChem (CID 139442666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).