C17H13N5O3 — CID 139442930
1-methyl-3-(1-phenylindazol-5-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 139442930) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is 1-methyl-3-(1-phenylindazol-5-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-methyl-3-(1-phenylindazol-5-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139442930 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-methyl-3-(1-phenylindazol-5-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)[nH]c(=O)n(-c2ccc3c(cnn3-c3ccccc3)c2)c1=O |
| InChI | InChI=1S/C17H13N5O3/c1-20-15(23)19-16(24)21(17(20)25)13-7-8-14-11(9-13)10-18-22(14)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,23,24) |
| InChIKey | VEAKRXRKYAZYGL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |