C19H18F2N4O3 — CID 139443085
N-[3-(1,1-difluoroethyl)phenyl]-1-(6-methoxy-3-pyridinyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 139443085) has the molecular formula C19H18F2N4O3 and a molecular weight of 388.37 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-1-(6-methoxy-3-pyridinyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-1-(6-methoxy-3-pyridinyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139443085 |
| Molecular Formula | C19H18F2N4O3 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-1-(6-methoxy-3-pyridinyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(N2N=C(C)C(C(=O)Nc3cccc(C(C)(F)F)c3)C2=O)cn1 |
| InChI | InChI=1S/C19H18F2N4O3/c1-11-16(17(26)23-13-6-4-5-12(9-13)19(2,20)21)18(27)25(24-11)14-7-8-15(28-3)22-10-14/h4-10,16H,1-3H3,(H,23,26) |
| InChIKey | QWGHASDPDLQLAP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|