About [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate
[2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate (PubChem CID 139443861) has the molecular formula C28H23NO5S
and a molecular weight of 485.56 g/mol. Its IUPAC name is [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate.
Molecular Properties
| Compound Name | [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate |
| PubChem CID | 139443861 |
| Molecular Formula | C28H23NO5S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)C1c1ccc2c(OS(=O)(=O)C3CCCCC3)cccc2n1 |
| InChI | InChI=1S/C28H23NO5S/c30-27-20-11-4-7-17-8-5-12-21(25(17)20)28(31)26(27)23-16-15-19-22(29-23)13-6-14-24(19)34-35(32,33)18-9-2-1-3-10-18/h4-8,11-16,18,26H,1-3,9-10H2 |
| InChIKey | IXZCYMKXIUYQDF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate?
The IUPAC name of [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate (CID 139443861) is [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate.
What is the SMILES notation for [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate?
The canonical SMILES for [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate is O=C1c2cccc3cccc(c23)C(=O)C1c1ccc2c(OS(=O)(=O)C3CCCCC3)cccc2n1.
What is the InChIKey of [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate?
The InChIKey is IXZCYMKXIUYQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23NO5S/c30-27-20-11-4-7-17-8-5-12-21(25(17)20)28(31)26(27)23-16-15-19-22(29-23)13-6-14-24(19)34-35(32,33)18-9-2-1-3-10-18/h4-8,11-16,18,26H,1-3,9-10H2.
What are the key properties of [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate?
[2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate has a molecular weight of 485.56 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxophenalen-2-yl)quinolin-5-yl] cyclohexanesulfonate is sourced from PubChem (CID 139443861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).