About 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine
1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine (PubChem CID 139443878) has the molecular formula C19H35N
and a molecular weight of 277.50 g/mol. Its IUPAC name is 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine.
Molecular Properties
| Compound Name | 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine |
| PubChem CID | 139443878 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine |
| SMILES | [H]/N=C(\C)C1CCC(C(C)C)CCCC1C(=C)C(C)(C)C |
| InChI | InChI=1S/C19H35N/c1-13(2)16-9-8-10-17(14(3)19(5,6)7)18(12-11-16)15(4)20/h13,16-18,20H,3,8-12H2,1-2,4-7H3/b20-15+ |
| InChIKey | HAIOUASQLLLQLR-HMMYKYKNSA-N |
| XLogP | 6.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine?
The IUPAC name of 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine (CID 139443878) is 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine.
What is the SMILES notation for 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine?
The canonical SMILES for 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine is [H]/N=C(\C)C1CCC(C(C)C)CCCC1C(=C)C(C)(C)C.
What is the InChIKey of 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine?
The InChIKey is HAIOUASQLLLQLR-HMMYKYKNSA-N. The full InChI is InChI=1S/C19H35N/c1-13(2)16-9-8-10-17(14(3)19(5,6)7)18(12-11-16)15(4)20/h13,16-18,20H,3,8-12H2,1-2,4-7H3/b20-15+.
What are the key properties of 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine?
1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine has a molecular weight of 277.50 g/mol, XLogP of 6.10, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,3-dimethylbut-1-en-2-yl)-6-propan-2-ylcyclooctyl]ethanimine is sourced from PubChem (CID 139443878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).