C16H28N2 — CID 139443879
1-tert-butyl-4,7-dimethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine (PubChem CID 139443879) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-tert-butyl-4,7-dimethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine.
| Compound Name | 1-tert-butyl-4,7-dimethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 139443879 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-tert-butyl-4,7-dimethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine |
| SMILES | CC1=NN=C(C(C)(C)C)C2CCCC(C)CCC12 |
| InChI | InChI=1S/C16H28N2/c1-11-7-6-8-14-13(10-9-11)12(2)17-18-15(14)16(3,4)5/h11,13-14H,6-10H2,1-5H3 |
| InChIKey | IVHHYGZBXVIZSU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |