About 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole
5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole (PubChem CID 139444204) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole |
| PubChem CID | 139444204 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole |
| SMILES | CCCCCCC(C)C1C=C(C)NN1 |
| InChI | InChI=1S/C12H24N2/c1-4-5-6-7-8-10(2)12-9-11(3)13-14-12/h9-10,12-14H,4-8H2,1-3H3 |
| InChIKey | GTSWCNPJDZANKY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole?
The IUPAC name of 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole (CID 139444204) is 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole.
What is the SMILES notation for 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole?
The canonical SMILES for 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole is CCCCCCC(C)C1C=C(C)NN1.
What is the InChIKey of 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole?
The InChIKey is GTSWCNPJDZANKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-4-5-6-7-8-10(2)12-9-11(3)13-14-12/h9-10,12-14H,4-8H2,1-3H3.
What are the key properties of 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole?
5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole has a molecular weight of 196.34 g/mol, XLogP of 2.97, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-octan-2-yl-2,3-dihydro-1H-pyrazole is sourced from PubChem (CID 139444204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).