C16H9F4N5O3 — CID 139444237
methyl 2,3,4,5-tetrafluoro-6-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate (PubChem CID 139444237) has the molecular formula C16H9F4N5O3 and a molecular weight of 395.27 g/mol. Its IUPAC name is methyl 2,3,4,5-tetrafluoro-6-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 2,3,4,5-tetrafluoro-6-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 139444237 |
| Molecular Formula | C16H9F4N5O3 |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl 2,3,4,5-tetrafluoro-6-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1c(F)c(F)c(F)c(F)c1NC(=O)c1ccc(-n2ccnc2)nn1 |
| InChI | InChI=1S/C16H9F4N5O3/c1-28-16(27)9-10(17)11(18)12(19)13(20)14(9)22-15(26)7-2-3-8(24-23-7)25-5-4-21-6-25/h2-6H,1H3,(H,22,26) |
| InChIKey | ODVSCNPIFNMEFD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|