C11H15NO4 — CID 139444368
methyl 7-(aminomethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 139444368) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl 7-(aminomethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 7-(aminomethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 139444368 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl 7-(aminomethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=COC(O)C2C(CN)=CCC12 |
| InChI | InChI=1S/C11H15NO4/c1-15-10(13)8-5-16-11(14)9-6(4-12)2-3-7(8)9/h2,5,7,9,11,14H,3-4,12H2,1H3 |
| InChIKey | KDMMLWNBAVPWMX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|