C18H20F3N5O4S2 — CID 139444876
2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridine (PubChem CID 139444876) has the molecular formula C18H20F3N5O4S2 and a molecular weight of 491.52 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139444876 |
| Molecular Formula | C18H20F3N5O4S2 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridine |
| SMILES | CCS(=O)(=O)c1c(-c2nc3cc(S(=O)(=O)C(F)(F)F)cnc3n2C)nn2c1CCC(C)C2 |
| InChI | InChI=1S/C18H20F3N5O4S2/c1-4-31(27,28)15-13-6-5-10(2)9-26(13)24-14(15)17-23-12-7-11(8-22-16(12)25(17)3)32(29,30)18(19,20)21/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | QDERZNAADOPEAG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 116.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |