C19H20F5N5O2S — CID 139444921
2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine (PubChem CID 139444921) has the molecular formula C19H20F5N5O2S and a molecular weight of 477.46 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139444921 |
| Molecular Formula | C19H20F5N5O2S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-(3-ethylsulfonyl-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine |
| SMILES | CCS(=O)(=O)c1c(-c2nc3cc(C(F)(F)C(F)(F)F)cnc3n2C)nn2c1CCC(C)C2 |
| InChI | InChI=1S/C19H20F5N5O2S/c1-4-32(30,31)15-13-6-5-10(2)9-29(13)27-14(15)17-26-12-7-11(8-25-16(12)28(17)3)18(20,21)19(22,23)24/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | YOLISDGHBUWJKH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|