C24H22O4 — CID 139444961
[(1S,14R)-9-methoxy-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] cyclohexa-1,5-dien-3-yne-1-carboxylate (PubChem CID 139444961) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(1S,14R)-9-methoxy-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] cyclohexa-1,5-dien-3-yne-1-carboxylate.
| Compound Name | [(1S,14R)-9-methoxy-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] cyclohexa-1,5-dien-3-yne-1-carboxylate |
|---|---|
| PubChem CID | 139444961 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [(1S,14R)-9-methoxy-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] cyclohexa-1,5-dien-3-yne-1-carboxylate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4cc#ccc4)C=C[C@@]31CCCC2 |
| InChI | InChI=1S/C24H22O4/c1-26-19-11-10-16-7-5-6-13-24-14-12-18(15-20(24)28-22(19)21(16)24)27-23(25)17-8-3-2-4-9-17/h3,8-12,14,18,20H,5-7,13,15H2,1H3/t18-,20?,24+/m0/s1 |
| InChIKey | FUDVHYMZWMEFJW-MQPQSNSUSA-N |
| XLogP | 4.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|