C19H17F8N5O2S — CID 139444985
2-[3-ethylsulfonyl-6-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine (PubChem CID 139444985) has the molecular formula C19H17F8N5O2S and a molecular weight of 531.43 g/mol. Its IUPAC name is 2-[3-ethylsulfonyl-6-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-[3-ethylsulfonyl-6-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139444985 |
| Molecular Formula | C19H17F8N5O2S |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 2-[3-ethylsulfonyl-6-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine |
| SMILES | CCS(=O)(=O)c1c(-c2nc3cc(C(F)(F)C(F)(F)F)cnc3n2C)nn2c1CCC(C(F)(F)F)C2 |
| InChI | InChI=1S/C19H17F8N5O2S/c1-3-35(33,34)14-12-5-4-9(18(22,23)24)8-32(12)30-13(14)16-29-11-6-10(7-28-15(11)31(16)2)17(20,21)19(25,26)27/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | ZAYKTDSPIUSRMY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|