C22H16F8N6O2 — CID 139445065
1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluoro-5-methylphenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol (PubChem CID 139445065) has the molecular formula C22H16F8N6O2 and a molecular weight of 548.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluoro-5-methylphenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluoro-5-methylphenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol |
|---|---|
| PubChem CID | 139445065 |
| Molecular Formula | C22H16F8N6O2 |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluoro-5-methylphenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol |
| SMILES | Cc1ccc(F)c(Cn2nc(-c3ncc(F)c(NCC(O)(C(F)(F)F)C(F)(F)F)n3)cc2-c2ccon2)c1 |
| InChI | InChI=1S/C22H16F8N6O2/c1-11-2-3-13(23)12(6-11)9-36-17(15-4-5-38-35-15)7-16(34-36)19-31-8-14(24)18(33-19)32-10-20(37,21(25,26)27)22(28,29)30/h2-8,37H,9-10H2,1H3,(H,31,32,33) |
| InChIKey | AEAQZYLMFFRQCZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |