About (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol
(2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol (PubChem CID 139445363) has the molecular formula C16H16F4O2
and a molecular weight of 316.29 g/mol. Its IUPAC name is (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol.
Molecular Properties
| Compound Name | (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol |
| PubChem CID | 139445363 |
| Molecular Formula | C16H16F4O2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol |
| SMILES | C=C(/C=C(\C)OC(F)(F)F)/C(=C(\C)CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16F4O2/c1-10(8-12(3)22-16(18,19)20)15(11(2)9-21)13-4-6-14(17)7-5-13/h4-8,21H,1,9H2,2-3H3/b12-8+,15-11- |
| InChIKey | VVGIODZCOQYHJS-KJNPNZLNSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol?
The IUPAC name of (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol (CID 139445363) is (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol.
What is the SMILES notation for (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol?
The canonical SMILES for (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol is C=C(/C=C(\C)OC(F)(F)F)/C(=C(\C)CO)c1ccc(F)cc1.
What is the InChIKey of (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol?
The InChIKey is VVGIODZCOQYHJS-KJNPNZLNSA-N. The full InChI is InChI=1S/C16H16F4O2/c1-10(8-12(3)22-16(18,19)20)15(11(2)9-21)13-4-6-14(17)7-5-13/h4-8,21H,1,9H2,2-3H3/b12-8+,15-11-.
What are the key properties of (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol?
(2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol has a molecular weight of 316.29 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,5E)-3-(4-fluorophenyl)-2-methyl-4-methylidene-6-(trifluoromethoxy)hepta-2,5-dien-1-ol is sourced from PubChem (CID 139445363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).