C21H23ClN4O2 — CID 139446415
2-chloro-1-[(1S)-1-[1-(oxan-4-yl)pyrazol-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 139446415) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-chloro-1-[(1S)-1-[1-(oxan-4-yl)pyrazol-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[(1S)-1-[1-(oxan-4-yl)pyrazol-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 139446415 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-chloro-1-[(1S)-1-[1-(oxan-4-yl)pyrazol-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | O=C(CCl)N1CCc2c([nH]c3ccccc23)[C@@H]1c1cnn(C2CCOCC2)c1 |
| InChI | InChI=1S/C21H23ClN4O2/c22-11-19(27)25-8-5-17-16-3-1-2-4-18(16)24-20(17)21(25)14-12-23-26(13-14)15-6-9-28-10-7-15/h1-4,12-13,15,21,24H,5-11H2/t21-/m0/s1 |
| InChIKey | YPQZFNZFLOGUFE-NRFANRHFSA-N |
| XLogP | 3.43 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|