C17H24N2O3 — CID 139446493
tert-butyl N-[(2S)-1-(5-methoxy-1H-indol-3-yl)propan-2-yl]carbamate (PubChem CID 139446493) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(5-methoxy-1H-indol-3-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(5-methoxy-1H-indol-3-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139446493 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-[(2S)-1-(5-methoxy-1H-indol-3-yl)propan-2-yl]carbamate |
| SMILES | COc1ccc2[nH]cc(C[C@H](C)NC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C17H24N2O3/c1-11(19-16(20)22-17(2,3)4)8-12-10-18-15-7-6-13(21-5)9-14(12)15/h6-7,9-11,18H,8H2,1-5H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | KSLVLUTUNBHNEH-NSHDSACASA-N |
| XLogP | 3.63 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |