C18H29N — CID 139446991
N-methyl-2-[2-(2,4,5-trimethylphenyl)ethyl]hex-5-en-1-amine (PubChem CID 139446991) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is N-methyl-2-[2-(2,4,5-trimethylphenyl)ethyl]hex-5-en-1-amine.
| Compound Name | N-methyl-2-[2-(2,4,5-trimethylphenyl)ethyl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 139446991 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-methyl-2-[2-(2,4,5-trimethylphenyl)ethyl]hex-5-en-1-amine |
| SMILES | C=CCCC(CCc1cc(C)c(C)cc1C)CNC |
| InChI | InChI=1S/C18H29N/c1-6-7-8-17(13-19-5)9-10-18-12-15(3)14(2)11-16(18)4/h6,11-12,17,19H,1,7-10,13H2,2-5H3 |
| InChIKey | FHBRHMJMMAYYMF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|