About 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide
4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide (PubChem CID 139446999) has the molecular formula C18H24N2O3S
and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide |
| PubChem CID | 139446999 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide |
| SMILES | CNC12C[C@H]3C[C@@H](C1)CC(NS(=O)(=O)c1ccc(C=O)cc1)(C3)C2 |
| InChI | InChI=1S/C18H24N2O3S/c1-19-17-7-14-6-15(8-17)10-18(9-14,12-17)20-24(22,23)16-4-2-13(11-21)3-5-16/h2-5,11,14-15,19-20H,6-10,12H2,1H3/t14-,15+,17?,18? |
| InChIKey | GEQFUEODRWKSST-BXXOZEPKSA-N |
| XLogP | 2.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide?
The IUPAC name of 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide (CID 139446999) is 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide.
What is the SMILES notation for 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide?
The canonical SMILES for 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide is CNC12C[C@H]3C[C@@H](C1)CC(NS(=O)(=O)c1ccc(C=O)cc1)(C3)C2.
What is the InChIKey of 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide?
The InChIKey is GEQFUEODRWKSST-BXXOZEPKSA-N. The full InChI is InChI=1S/C18H24N2O3S/c1-19-17-7-14-6-15(8-17)10-18(9-14,12-17)20-24(22,23)16-4-2-13(11-21)3-5-16/h2-5,11,14-15,19-20H,6-10,12H2,1H3/t14-,15+,17?,18?.
What are the key properties of 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide?
4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide has a molecular weight of 348.47 g/mol, XLogP of 2.09, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formyl-N-[(5S,7R)-3-(methylamino)-1-adamantyl]benzenesulfonamide is sourced from PubChem (CID 139446999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).