C23H29FN2 — CID 139447422
(6aS)-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-6a,8-dimethyl-1,2,10a,11-tetrahydrobenzo[b][1]benzazepine (PubChem CID 139447422) has the molecular formula C23H29FN2 and a molecular weight of 352.50 g/mol. Its IUPAC name is (6aS)-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-6a,8-dimethyl-1,2,10a,11-tetrahydrobenzo[b][1]benzazepine.
| Compound Name | (6aS)-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-6a,8-dimethyl-1,2,10a,11-tetrahydrobenzo[b][1]benzazepine |
|---|---|
| PubChem CID | 139447422 |
| Molecular Formula | C23H29FN2 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (6aS)-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-6a,8-dimethyl-1,2,10a,11-tetrahydrobenzo[b][1]benzazepine |
| SMILES | CCN1CC=C(C2=C[C@]3(C)C=C(C)C=CC3NC3=C2C=C(F)CC3)CC1 |
| InChI | InChI=1S/C23H29FN2/c1-4-26-11-9-17(10-12-26)20-15-23(3)14-16(2)5-8-22(23)25-21-7-6-18(24)13-19(20)21/h5,8-9,13-15,22,25H,4,6-7,10-12H2,1-3H3/t22?,23-/m0/s1 |
| InChIKey | DEMIFCYPNREYIH-WCSIJFPASA-N |
| XLogP | 4.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |