C12H18N2O — CID 139447618
trans-(1S,3S)-3-(2-aminoanilino)cyclohexan-1-ol (PubChem CID 139447618) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is trans-(1S,3S)-3-(2-aminoanilino)cyclohexan-1-ol.
| Compound Name | trans-(1S,3S)-3-(2-aminoanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139447618 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | trans-(1S,3S)-3-(2-aminoanilino)cyclohexan-1-ol |
| SMILES | Nc1ccccc1N[C@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C12H18N2O/c13-11-6-1-2-7-12(11)14-9-4-3-5-10(15)8-9/h1-2,6-7,9-10,14-15H,3-5,8,13H2/t9-,10-/m0/s1 |
| InChIKey | XTWHHHIVEVBFNP-UWVGGRQHSA-N |
| XLogP | 1.98 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|