C29H32F3N7O3 — CID 139447938
4-(6-aminopurin-9-yl)-2-[[2-[2-tert-butyl-7-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol (PubChem CID 139447938) has the molecular formula C29H32F3N7O3 and a molecular weight of 583.62 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-2-[[2-[2-tert-butyl-7-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | 4-(6-aminopurin-9-yl)-2-[[2-[2-tert-butyl-7-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139447938 |
| Molecular Formula | C29H32F3N7O3 |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-2-[[2-[2-tert-butyl-7-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol |
| SMILES | CC(C)(C)c1ccc2c3ccc(C(F)(F)F)cc3n(CCNCC3OCC(O)(n4cnc5c(N)ncnc54)C3O)c2c1 |
| InChI | InChI=1S/C29H32F3N7O3/c1-27(2,3)16-4-6-18-19-7-5-17(29(30,31)32)11-21(19)38(20(18)10-16)9-8-34-12-22-24(40)28(41,13-42-22)39-15-37-23-25(33)35-14-36-26(23)39/h4-7,10-11,14-15,22,24,34,40-41H,8-9,12-13H2,1-3H3,(H2,33,35,36) |
| InChIKey | MTVNWLXQOXQBHY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|