C26H26F3N7O3 — CID 139448115
4-(6-aminopurin-9-yl)-2-[[2-[6-methyl-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol (PubChem CID 139448115) has the molecular formula C26H26F3N7O3 and a molecular weight of 541.53 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-2-[[2-[6-methyl-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | 4-(6-aminopurin-9-yl)-2-[[2-[6-methyl-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139448115 |
| Molecular Formula | C26H26F3N7O3 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-2-[[2-[6-methyl-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol |
| SMILES | Cc1ccc2c(c1)c1ccc(C(F)(F)F)cc1n2CCNCC1OCC(O)(n2cnc3c(N)ncnc32)C1O |
| InChI | InChI=1S/C26H26F3N7O3/c1-14-2-5-18-17(8-14)16-4-3-15(26(27,28)29)9-19(16)35(18)7-6-31-10-20-22(37)25(38,11-39-20)36-13-34-21-23(30)32-12-33-24(21)36/h2-5,8-9,12-13,20,22,31,37-38H,6-7,10-11H2,1H3,(H2,30,32,33) |
| InChIKey | YMPVYOAHBMIHBN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|