About 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine
3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine (PubChem CID 139448349) has the molecular formula C14H19Cl2N
and a molecular weight of 272.22 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine |
| PubChem CID | 139448349 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine |
| SMILES | CN(C)C1CCCC(c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C14H19Cl2N/c1-17(2)12-5-3-4-10(8-12)13-9-11(15)6-7-14(13)16/h6-7,9-10,12H,3-5,8H2,1-2H3 |
| InChIKey | XQWUHGYPWJNATM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine?
The IUPAC name of 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine (CID 139448349) is 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine.
What is the SMILES notation for 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine?
The canonical SMILES for 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine is CN(C)C1CCCC(c2cc(Cl)ccc2Cl)C1.
What is the InChIKey of 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine?
The InChIKey is XQWUHGYPWJNATM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2N/c1-17(2)12-5-3-4-10(8-12)13-9-11(15)6-7-14(13)16/h6-7,9-10,12H,3-5,8H2,1-2H3.
What are the key properties of 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine?
3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine has a molecular weight of 272.22 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dichlorophenyl)-N,N-dimethylcyclohexan-1-amine is sourced from PubChem (CID 139448349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).