About 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine
11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine (PubChem CID 139448441) has the molecular formula C13H11IN2
and a molecular weight of 322.15 g/mol. Its IUPAC name is 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine |
| PubChem CID | 139448441 |
| Molecular Formula | C13H11IN2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine |
| SMILES | IN1c2ccccc2CNc2ccccc21 |
| InChI | InChI=1S/C13H11IN2/c14-16-12-7-3-1-5-10(12)9-15-11-6-2-4-8-13(11)16/h1-8,15H,9H2 |
| InChIKey | XVUFZRUZSVHGCZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine?
The IUPAC name of 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine (CID 139448441) is 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine.
What is the SMILES notation for 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine?
The canonical SMILES for 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine is IN1c2ccccc2CNc2ccccc21.
What is the InChIKey of 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine?
The InChIKey is XVUFZRUZSVHGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11IN2/c14-16-12-7-3-1-5-10(12)9-15-11-6-2-4-8-13(11)16/h1-8,15H,9H2.
What are the key properties of 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine?
11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine has a molecular weight of 322.15 g/mol, XLogP of 4.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-iodo-5,6-dihydrobenzo[b][1,4]benzodiazepine is sourced from PubChem (CID 139448441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).