C14H14INO — CID 139448483
11-iodo-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazepin-5-one (PubChem CID 139448483) has the molecular formula C14H14INO and a molecular weight of 339.18 g/mol. Its IUPAC name is 11-iodo-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazepin-5-one.
| Compound Name | 11-iodo-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazepin-5-one |
|---|---|
| PubChem CID | 139448483 |
| Molecular Formula | C14H14INO |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 11-iodo-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazepin-5-one |
| SMILES | O=C1CC2=C(CCCC2)N(I)c2ccccc21 |
| InChI | InChI=1S/C14H14INO/c15-16-12-7-3-1-5-10(12)9-14(17)11-6-2-4-8-13(11)16/h2,4,6,8H,1,3,5,7,9H2 |
| InChIKey | GMFHSHURFNUJDQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|