C39H24Br3N3 — CID 139448704
3-[3-[3,5-bis(3-bromo-5-pyridin-3-ylphenyl)phenyl]-5-bromophenyl]pyridine (PubChem CID 139448704) has the molecular formula C39H24Br3N3 and a molecular weight of 774.35 g/mol. Its IUPAC name is 3-[3-[3,5-bis(3-bromo-5-pyridin-3-ylphenyl)phenyl]-5-bromophenyl]pyridine.
| Compound Name | 3-[3-[3,5-bis(3-bromo-5-pyridin-3-ylphenyl)phenyl]-5-bromophenyl]pyridine |
|---|---|
| PubChem CID | 139448704 |
| Molecular Formula | C39H24Br3N3 |
| Molecular Weight | 774.35 g/mol |
| Exact Mass | 770.95 |
| IUPAC Name | 3-[3-[3,5-bis(3-bromo-5-pyridin-3-ylphenyl)phenyl]-5-bromophenyl]pyridine |
| SMILES | Brc1cc(-c2cccnc2)cc(-c2cc(-c3cc(Br)cc(-c4cccnc4)c3)cc(-c3cc(Br)cc(-c4cccnc4)c3)c2)c1 |
| InChI | InChI=1S/C39H24Br3N3/c40-37-16-31(25-4-1-7-43-22-25)13-34(19-37)28-10-29(35-14-32(17-38(41)20-35)26-5-2-8-44-23-26)12-30(11-28)36-15-33(18-39(42)21-36)27-6-3-9-45-24-27/h1-24H |
| InChIKey | VKQSSMYNKKCCFD-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.35 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |