C8H11NS — CID 139448852
2,4,4a,8a-tetrahydro-1H-3,1-benzothiazine (PubChem CID 139448852) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 2,4,4a,8a-tetrahydro-1H-3,1-benzothiazine.
| Compound Name | 2,4,4a,8a-tetrahydro-1H-3,1-benzothiazine |
|---|---|
| PubChem CID | 139448852 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 2,4,4a,8a-tetrahydro-1H-3,1-benzothiazine |
| SMILES | C1=CC2CSCNC2C=C1 |
| InChI | InChI=1S/C8H11NS/c1-2-4-8-7(3-1)5-10-6-9-8/h1-4,7-9H,5-6H2 |
| InChIKey | HONAVKKSOYJWQW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |