C27H31ClF4N6O3S — CID 139448853
5-chloro-4-[[(4S)-2-[[2-(dimethylamino)-1-hydroxyethyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 139448853) has the molecular formula C27H31ClF4N6O3S and a molecular weight of 631.10 g/mol. Its IUPAC name is 5-chloro-4-[[(4S)-2-[[2-(dimethylamino)-1-hydroxyethyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 5-chloro-4-[[(4S)-2-[[2-(dimethylamino)-1-hydroxyethyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 139448853 |
| Molecular Formula | C27H31ClF4N6O3S |
| Molecular Weight | 631.10 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | 5-chloro-4-[[(4S)-2-[[2-(dimethylamino)-1-hydroxyethyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | CN(C)CC(O)NC1C[C@@H](c2cccc(C(F)(F)F)c2)CCC1Nc1cc(F)c(S(=O)(=O)Nc2ccncn2)cc1Cl |
| InChI | InChI=1S/C27H31ClF4N6O3S/c1-38(2)14-26(39)36-23-11-17(16-4-3-5-18(10-16)27(30,31)32)6-7-21(23)35-22-13-20(29)24(12-19(22)28)42(40,41)37-25-8-9-33-15-34-25/h3-5,8-10,12-13,15,17,21,23,26,35-36,39H,6-7,11,14H2,1-2H3,(H,33,34,37)/t17-,21?,23?,26?/m0/s1 |
| InChIKey | VJSLMBZWOHZNLG-QKYRXOBTSA-N |
| XLogP | 4.68 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.10 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|