C28H33ClF4N6O3S — CID 139448856
4-[[(4S)-2-[[(2S)-2-amino-1-hydroxy-3-methylbutyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-5-chloro-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 139448856) has the molecular formula C28H33ClF4N6O3S and a molecular weight of 645.12 g/mol. Its IUPAC name is 4-[[(4S)-2-[[(2S)-2-amino-1-hydroxy-3-methylbutyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-5-chloro-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-[[(4S)-2-[[(2S)-2-amino-1-hydroxy-3-methylbutyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-5-chloro-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 139448856 |
| Molecular Formula | C28H33ClF4N6O3S |
| Molecular Weight | 645.12 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | 4-[[(4S)-2-[[(2S)-2-amino-1-hydroxy-3-methylbutyl]amino]-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-5-chloro-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | CC(C)[C@H](N)C(O)NC1C[C@@H](c2cccc(C(F)(F)F)c2)CCC1Nc1cc(F)c(S(=O)(=O)Nc2ccncn2)cc1Cl |
| InChI | InChI=1S/C28H33ClF4N6O3S/c1-15(2)26(34)27(40)38-23-11-17(16-4-3-5-18(10-16)28(31,32)33)6-7-21(23)37-22-13-20(30)24(12-19(22)29)43(41,42)39-25-8-9-35-14-36-25/h3-5,8-10,12-15,17,21,23,26-27,37-38,40H,6-7,11,34H2,1-2H3,(H,35,36,39)/t17-,21?,23?,26-,27?/m0/s1 |
| InChIKey | AFQMHABPJILOQU-NTQOVJQCSA-N |
| XLogP | 5.10 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.12 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|