About 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine
1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine (PubChem CID 139449500) has the molecular formula C16H14N4
and a molecular weight of 262.32 g/mol. Its IUPAC name is 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine |
| PubChem CID | 139449500 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine |
| SMILES | Cn1cc(Cc2cnc3[nH]ccc3c2)c2ccncc21 |
| InChI | InChI=1S/C16H14N4/c1-20-10-13(14-3-4-17-9-15(14)20)7-11-6-12-2-5-18-16(12)19-8-11/h2-6,8-10H,7H2,1H3,(H,18,19) |
| InChIKey | XSGDGZHOIFZDBX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine?
The IUPAC name of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine (CID 139449500) is 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine?
The canonical SMILES for 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine is Cn1cc(Cc2cnc3[nH]ccc3c2)c2ccncc21.
What is the InChIKey of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine?
The InChIKey is XSGDGZHOIFZDBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4/c1-20-10-13(14-3-4-17-9-15(14)20)7-11-6-12-2-5-18-16(12)19-8-11/h2-6,8-10H,7H2,1H3,(H,18,19).
What are the key properties of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine?
1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine has a molecular weight of 262.32 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 139449500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).