About 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine
5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine (PubChem CID 139449779) has the molecular formula C23H17F2N3
and a molecular weight of 373.41 g/mol. Its IUPAC name is 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine |
| PubChem CID | 139449779 |
| Molecular Formula | C23H17F2N3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(Cc2ccccc2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C23H17F2N3/c24-18-10-6-16(7-11-18)21-20(14-15-4-2-1-3-5-15)22(28-23(26)27-21)17-8-12-19(25)13-9-17/h1-13H,14H2,(H2,26,27,28) |
| InChIKey | JCDOFALEDGAJTN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine?
The IUPAC name of 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine (CID 139449779) is 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine.
What is the SMILES notation for 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine?
The canonical SMILES for 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine is Nc1nc(-c2ccc(F)cc2)c(Cc2ccccc2)c(-c2ccc(F)cc2)n1.
What is the InChIKey of 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine?
The InChIKey is JCDOFALEDGAJTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F2N3/c24-18-10-6-16(7-11-18)21-20(14-15-4-2-1-3-5-15)22(28-23(26)27-21)17-8-12-19(25)13-9-17/h1-13H,14H2,(H2,26,27,28).
What are the key properties of 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine?
5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine has a molecular weight of 373.41 g/mol, XLogP of 5.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-4,6-bis(4-fluorophenyl)pyrimidin-2-amine is sourced from PubChem (CID 139449779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).