About [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid
[1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid (PubChem CID 139450994) has the molecular formula C11H9BrF2N2O3
and a molecular weight of 335.10 g/mol. Its IUPAC name is [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid |
| PubChem CID | 139450994 |
| Molecular Formula | C11H9BrF2N2O3 |
| Molecular Weight | 335.10 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2ccc(Br)c(F)c2F)C1=O |
| InChI | InChI=1S/C11H9BrF2N2O3/c12-5-1-2-7(9(14)8(5)13)16-4-3-6(10(16)17)15-11(18)19/h1-2,6,15H,3-4H2,(H,18,19) |
| InChIKey | DWQLIZMKAGTQDO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid?
The IUPAC name of [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid (CID 139450994) is [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid.
What is the SMILES notation for [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid?
The canonical SMILES for [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid is O=C(O)NC1CCN(c2ccc(Br)c(F)c2F)C1=O.
What is the InChIKey of [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid?
The InChIKey is DWQLIZMKAGTQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrF2N2O3/c12-5-1-2-7(9(14)8(5)13)16-4-3-6(10(16)17)15-11(18)19/h1-2,6,15H,3-4H2,(H,18,19).
What are the key properties of [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid?
[1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid has a molecular weight of 335.10 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromo-2,3-difluorophenyl)-2-oxopyrrolidin-3-yl]carbamic acid is sourced from PubChem (CID 139450994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).