C19H21F2N2O2P — CID 139451005
3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]-5-methylpyrrolidin-2-one (PubChem CID 139451005) has the molecular formula C19H21F2N2O2P and a molecular weight of 378.36 g/mol. Its IUPAC name is 3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]-5-methylpyrrolidin-2-one.
| Compound Name | 3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 139451005 |
| Molecular Formula | C19H21F2N2O2P |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]-5-methylpyrrolidin-2-one |
| SMILES | CC1CC(N)C(=O)N1c1ccc(-c2ccccc2P(C)(C)=O)c(F)c1F |
| InChI | InChI=1S/C19H21F2N2O2P/c1-11-10-14(22)19(24)23(11)15-9-8-13(17(20)18(15)21)12-6-4-5-7-16(12)26(2,3)25/h4-9,11,14H,10,22H2,1-3H3 |
| InChIKey | HFQNVGCTXYNZMI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|