C14H18F3N3O5S2 — CID 139451213
2-(2,2-dimethylpropylsulfanyl)-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid (PubChem CID 139451213) has the molecular formula C14H18F3N3O5S2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylsulfanyl)-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid.
| Compound Name | 2-(2,2-dimethylpropylsulfanyl)-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid |
|---|---|
| PubChem CID | 139451213 |
| Molecular Formula | C14H18F3N3O5S2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-(2,2-dimethylpropylsulfanyl)-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid |
| SMILES | CC(C)(C)CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(C(=O)O)C2 |
| InChI | InChI=1S/C14H18F3N3O5S2/c1-13(2,3)7-26-11-18-9-6-20(12(21)22)5-4-8(9)10(19-11)25-27(23,24)14(15,16)17/h4-7H2,1-3H3,(H,21,22) |
| InChIKey | BJXVLLPXUOZDQN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|