About N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide
N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide (PubChem CID 139451767) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide |
| PubChem CID | 139451767 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide |
| SMILES | COc1ccc2nc(OC)n(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C13H17N3O3/c1-9(17)14-6-7-16-12-8-10(18-2)4-5-11(12)15-13(16)19-3/h4-5,8H,6-7H2,1-3H3,(H,14,17) |
| InChIKey | OSKMTHQTYBZVLY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide?
The IUPAC name of N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide (CID 139451767) is N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide is COc1ccc2nc(OC)n(CCNC(C)=O)c2c1.
What is the InChIKey of N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide?
The InChIKey is OSKMTHQTYBZVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-9(17)14-6-7-16-12-8-10(18-2)4-5-11(12)15-13(16)19-3/h4-5,8H,6-7H2,1-3H3,(H,14,17).
What are the key properties of N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide?
N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide has a molecular weight of 263.30 g/mol, XLogP of 1.19, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide is sourced from PubChem (CID 139451767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).