C13H17N3O3 — CID 139451767
N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide (PubChem CID 139451767) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide.
| Compound Name | N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 139451767 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-(2,6-dimethoxybenzimidazol-1-yl)ethyl]acetamide |
| SMILES | COc1ccc2nc(OC)n(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C13H17N3O3/c1-9(17)14-6-7-16-12-8-10(18-2)4-5-11(12)15-13(16)19-3/h4-5,8H,6-7H2,1-3H3,(H,14,17) |
| InChIKey | OSKMTHQTYBZVLY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |