C14H16F14N3O5S+ — CID 139452231
3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(sulfomethyl)azanium (PubChem CID 139452231) has the molecular formula C14H16F14N3O5S+ and a molecular weight of 604.34 g/mol. Its IUPAC name is 3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(sulfomethyl)azanium.
| Compound Name | 3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(sulfomethyl)azanium |
|---|---|
| PubChem CID | 139452231 |
| Molecular Formula | C14H16F14N3O5S+ |
| Molecular Weight | 604.34 g/mol |
| Exact Mass | 604.06 |
| IUPAC Name | 3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(sulfomethyl)azanium |
| SMILES | C[N+](C)(CCCNC(=O)C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)CS(=O)(=O)O |
| InChI | InChI=1S/C14H15F14N3O5S/c1-31(2,6-37(33,34)35)5-3-4-29-7(32)8(15,9(16,17)18)10(19,20)30-11(21,22)13(25,26)36-14(27,28)12(30,23)24/h3-6H2,1-2H3,(H-,29,32,33,34,35)/p+1 |
| InChIKey | JSDGNGLBMHNFFX-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|