About 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid
2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid (PubChem CID 139452345) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid |
| PubChem CID | 139452345 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(C)C(=O)NCCNC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H22N2O3/c1-10(2,3)8(14)12-6-7-13-11(4,5)9(15)16/h13H,6-7H2,1-5H3,(H,12,14)(H,15,16) |
| InChIKey | DGUMNCMCLXNCKR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid?
The IUPAC name of 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid (CID 139452345) is 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid?
The canonical SMILES for 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid is CC(C)(C)C(=O)NCCNC(C)(C)C(=O)O.
What is the InChIKey of 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid?
The InChIKey is DGUMNCMCLXNCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-10(2,3)8(14)12-6-7-13-11(4,5)9(15)16/h13H,6-7H2,1-5H3,(H,12,14)(H,15,16).
What are the key properties of 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid?
2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid has a molecular weight of 230.31 g/mol, XLogP of 0.60, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-dimethylpropanoylamino)ethylamino]-2-methylpropanoic acid is sourced from PubChem (CID 139452345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).