About trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine
trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine (PubChem CID 139452466) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine |
| PubChem CID | 139452466 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine |
| SMILES | CC=CCN[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C10H20N2/c1-2-3-8-12-10-7-5-4-6-9(10)11/h2-3,9-10,12H,4-8,11H2,1H3/t9-,10-/m1/s1 |
| InChIKey | UKZNQCFEKKIAJQ-NXEZZACHSA-N |
| XLogP | 1.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine?
The IUPAC name of trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine (CID 139452466) is trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine.
What is the SMILES notation for trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine?
The canonical SMILES for trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine is CC=CCN[C@@H]1CCCC[C@H]1N.
What is the InChIKey of trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine?
The InChIKey is UKZNQCFEKKIAJQ-NXEZZACHSA-N. The full InChI is InChI=1S/C10H20N2/c1-2-3-8-12-10-7-5-4-6-9(10)11/h2-3,9-10,12H,4-8,11H2,1H3/t9-,10-/m1/s1.
What are the key properties of trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine?
trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine has a molecular weight of 168.28 g/mol, XLogP of 1.42, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-N-but-2-enylcyclohexane-1,2-diamine is sourced from PubChem (CID 139452466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).